claraesson3195 claraesson3195

03-03-2020
Biology

contestada

What is a possible outcome of persistent geographical isolation of two populations?

Respuesta :

felicia47singh felicia47singh

03-03-2020

Answer: Allopathic speciation could occur.

Explanation:

Answer Link

Otras preguntas

Julian designs an experiment to see how well different liquids lubricate wooden surfaces. He sets up a number of identical wooden ramps and prepares to slide id

A skier pushes her ski poles against the ground . Identify the action and reaction forces in this example and explain why the skier moves but earth does not see

Read the passage from "Cinderella" by the Brothers Grimm. The stepmother is most likely motivated by A greed B love for her daughters. C Jealousy. D fear of he

cosec(6b+pi/8)=sec(2b-pi/8)

If the simple interest on $6,000 for 2 years is $840, then what is the interest rate?

Relative velocity.....Please help....

PLEASE HELP me find the rest of the angles. The big triangle problem

If someone could work out the first half of the problem and explain that would be great!

Identify for farming methods that result in soil conversation

5. What is the conflict of the novel? A. What will Charlie wear for Halloween? B. Why are the Herdmans so bad? C. How will Halloween be fun this year? D. Where