churchillvanessam churchillvanessam

03-10-2020
Chemistry

contestada

For NH4NO3(s) write a balanced thermochemical equation.

Respuesta :

sagarsaud666 sagarsaud666

03-10-2020

Answer:

step1

NH4NO3(s)+H2O(I)--------->NH⁴OH(aq)+HNO³(aq)

step²

NH⁴OH(aq)+HNO³(aq)-------->NH⁴+(aq)+NO³-(aq)+H²O(I)

Answer Link

Otras preguntas

PLEASE ANSWEAR IM FALLING MATH :((( .. Maniah has a meal in a restaurant. She adds up the prices listed on the menu for everything they ordered and gets a subto

Which of the following best describes the purpose of the Nucleus to store the genetic information and is the control center of the cell to release energy by bre

the reason physical state affect the rate of a chemical rection

Simplify this expression 3x^2 x 4x^5

the cost of fencing a Square Garden is 400 at the rate of 1 per metre find its length

What was malala's ambition before and why did she change her ambition Why does Malala believe in the power of politics to change the world?

What do you think it means to be awarded the Nobel Prize for peace?

can you please help me i need help

At Christmas, Uncle Jack gives the kids a gift. What is it? Why does Atticus let them have it?

What is the primary factor that determines what a star's life path will be? Its brightness Its mass Its temperature Its distance fro